C10H20BN5O4 — CID 170795382
4-[5-(1-amino-5-boronopentyl)tetrazol-1-yl]butanoic acid (PubChem CID 170795382) has the molecular formula C10H20BN5O4 and a molecular weight of 285.11 g/mol. Its IUPAC name is 4-[5-(1-amino-5-boronopentyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 4-[5-(1-amino-5-boronopentyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 170795382 |
| Molecular Formula | C10H20BN5O4 |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-[5-(1-amino-5-boronopentyl)tetrazol-1-yl]butanoic acid |
| SMILES | NC(CCCCB(O)O)c1nnnn1CCCC(=O)O |
| InChI | InChI=1S/C10H20BN5O4/c12-8(4-1-2-6-11(19)20)10-13-14-15-16(10)7-3-5-9(17)18/h8,19-20H,1-7,12H2,(H,17,18) |
| InChIKey | GOUHCRMVMOBJFG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|