4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid

C11H10Br2N4O2 — CID 114023073

IUPAC4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid
SMILESO=C(O)CCCn1nnnc1-c1cc(Br)cc(Br)c1
InChIInChI=1S/C11H10Br2N4O2/c12-8-4-7(5-9(13)6-8)11-14-15-16-17(11)3-1-2-10(18)19/h4-6H,1-3H2,(H,18,19)
InChIKeyUXKOTJSJNJIOTK-UHFFFAOYSA-N
MW390.04 g/mol
LogP2.73
Rot. Bonds5

About 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid

4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid (PubChem CID 114023073) has the molecular formula C11H10Br2N4O2 and a molecular weight of 390.04 g/mol. Its IUPAC name is 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid.

Molecular Properties

Compound Name4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid
PubChem CID114023073
Molecular FormulaC11H10Br2N4O2
Molecular Weight390.04 g/mol
Exact Mass387.92
IUPAC Name4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid
SMILESO=C(O)CCCn1nnnc1-c1cc(Br)cc(Br)c1
InChIInChI=1S/C11H10Br2N4O2/c12-8-4-7(5-9(13)6-8)11-14-15-16-17(11)3-1-2-10(18)19/h4-6H,1-3H2,(H,18,19)
InChIKeyUXKOTJSJNJIOTK-UHFFFAOYSA-N
XLogP2.73
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500390.04
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid?
The IUPAC name of 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid (CID 114023073) is 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid.
What is the SMILES notation for 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid?
The canonical SMILES for 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid is O=C(O)CCCn1nnnc1-c1cc(Br)cc(Br)c1.
What is the InChIKey of 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid?
The InChIKey is UXKOTJSJNJIOTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br2N4O2/c12-8-4-7(5-9(13)6-8)11-14-15-16-17(11)3-1-2-10(18)19/h4-6H,1-3H2,(H,18,19).
What are the key properties of 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid?
4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid has a molecular weight of 390.04 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,5-dibromophenyl)tetrazol-1-yl]butanoic acid is sourced from PubChem (CID 114023073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).