C11H9F3N4O2 — CID 66046763
4-[5-(2,4,6-trifluorophenyl)tetrazol-1-yl]butanoic acid (PubChem CID 66046763) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 4-[5-(2,4,6-trifluorophenyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 4-[5-(2,4,6-trifluorophenyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 66046763 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-[5-(2,4,6-trifluorophenyl)tetrazol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1nnnc1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H9F3N4O2/c12-6-4-7(13)10(8(14)5-6)11-15-16-17-18(11)3-1-2-9(19)20/h4-5H,1-3H2,(H,19,20) |
| InChIKey | DHSONYAOBCDVTQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |