C11H10BrFN4O2 — CID 114020246
4-[5-(3-bromo-4-fluorophenyl)tetrazol-1-yl]butanoic acid (PubChem CID 114020246) has the molecular formula C11H10BrFN4O2 and a molecular weight of 329.13 g/mol. Its IUPAC name is 4-[5-(3-bromo-4-fluorophenyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 4-[5-(3-bromo-4-fluorophenyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 114020246 |
| Molecular Formula | C11H10BrFN4O2 |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-[5-(3-bromo-4-fluorophenyl)tetrazol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1nnnc1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H10BrFN4O2/c12-8-6-7(3-4-9(8)13)11-14-15-16-17(11)5-1-2-10(18)19/h3-4,6H,1-2,5H2,(H,18,19) |
| InChIKey | RXXKDDUWLDTTQZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |