C15H21BF2N6O3 — CID 170795435
[5-amino-5-[1-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid (PubChem CID 170795435) has the molecular formula C15H21BF2N6O3 and a molecular weight of 382.18 g/mol. Its IUPAC name is [5-amino-5-[1-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid.
| Compound Name | [5-amino-5-[1-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid |
|---|---|
| PubChem CID | 170795435 |
| Molecular Formula | C15H21BF2N6O3 |
| Molecular Weight | 382.18 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [5-amino-5-[1-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid |
| SMILES | NC(CCCCB(O)O)c1nnnn1CC(=O)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H21BF2N6O3/c17-11-5-10(6-12(18)7-11)8-20-14(25)9-24-15(21-22-23-24)13(19)3-1-2-4-16(26)27/h5-7,13,26-27H,1-4,8-9,19H2,(H,20,25) |
| InChIKey | USHAXCMVYBAJMS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|