C16H25BN6O3 — CID 174218319
[5-amino-5-[1-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-5-yl]pentyl]boronic acid (PubChem CID 174218319) has the molecular formula C16H25BN6O3 and a molecular weight of 360.23 g/mol. Its IUPAC name is [5-amino-5-[1-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-5-yl]pentyl]boronic acid.
| Compound Name | [5-amino-5-[1-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-5-yl]pentyl]boronic acid |
|---|---|
| PubChem CID | 174218319 |
| Molecular Formula | C16H25BN6O3 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [5-amino-5-[1-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-5-yl]pentyl]boronic acid |
| SMILES | CC(NC(=O)Cn1nnnc1C(N)CCCCB(O)O)c1ccccc1 |
| InChI | InChI=1S/C16H25BN6O3/c1-12(13-7-3-2-4-8-13)19-15(24)11-23-16(20-21-22-23)14(18)9-5-6-10-17(25)26/h2-4,7-8,12,14,25-26H,5-6,9-11,18H2,1H3,(H,19,24) |
| InChIKey | SCPCLZIDLGHHCN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|