C41H49BN6O3 — CID 174218312
N-(1-phenylethyl)-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide (PubChem CID 174218312) has the molecular formula C41H49BN6O3 and a molecular weight of 684.69 g/mol. Its IUPAC name is N-(1-phenylethyl)-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide.
| Compound Name | N-(1-phenylethyl)-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 174218312 |
| Molecular Formula | C41H49BN6O3 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.40 |
| IUPAC Name | N-(1-phenylethyl)-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
| SMILES | CC(NC(=O)Cn1nnnc1C(CCCCB1OC(C)(C)C(C)(C)O1)NC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H49BN6O3/c1-31(32-20-10-6-11-21-32)43-37(49)30-48-38(45-46-47-48)36(28-18-19-29-42-50-39(2,3)40(4,5)51-42)44-41(33-22-12-7-13-23-33,34-24-14-8-15-25-34)35-26-16-9-17-27-35/h6-17,20-27,31,36,44H,18-19,28-30H2,1-5H3,(H,43,49) |
| InChIKey | QIEGBTLMTGBNFD-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|