C37H49BN6O3 — CID 171058031
N-butyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide (PubChem CID 171058031) has the molecular formula C37H49BN6O3 and a molecular weight of 636.65 g/mol. Its IUPAC name is N-butyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide.
| Compound Name | N-butyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 171058031 |
| Molecular Formula | C37H49BN6O3 |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | N-butyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
| SMILES | CCCCNC(=O)Cn1nnnc1C(CCCCB1OC(C)(C)C(C)(C)O1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H49BN6O3/c1-6-7-27-39-33(45)28-44-34(41-42-43-44)32(25-17-18-26-38-46-35(2,3)36(4,5)47-38)40-37(29-19-11-8-12-20-29,30-21-13-9-14-22-30)31-23-15-10-16-24-31/h8-16,19-24,32,40H,6-7,17-18,25-28H2,1-5H3,(H,39,45) |
| InChIKey | KPMMSAPWZYHTDP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|