C39H46BN5O2 — CID 174218306
1-[1-[(1S)-1-phenylethyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine (PubChem CID 174218306) has the molecular formula C39H46BN5O2 and a molecular weight of 627.64 g/mol. Its IUPAC name is 1-[1-[(1S)-1-phenylethyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine.
| Compound Name | 1-[1-[(1S)-1-phenylethyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine |
|---|---|
| PubChem CID | 174218306 |
| Molecular Formula | C39H46BN5O2 |
| Molecular Weight | 627.64 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | 1-[1-[(1S)-1-phenylethyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine |
| SMILES | C[C@@H](c1ccccc1)n1nnnc1C(CCCCB1OC(C)(C)C(C)(C)O1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H46BN5O2/c1-30(31-20-10-6-11-21-31)45-36(42-43-44-45)35(28-18-19-29-40-46-37(2,3)38(4,5)47-40)41-39(32-22-12-7-13-23-32,33-24-14-8-15-25-33)34-26-16-9-17-27-34/h6-17,20-27,30,35,41H,18-19,28-29H2,1-5H3/t30-,35?/m0/s1 |
| InChIKey | OSHMXUBPKFPBJS-KIYCQYGCSA-N |
| XLogP | 8.17 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.64 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|