C40H44BF3N6O3 — CID 171058063
2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]-N-[(3,4,5-trifluorophenyl)methyl]acetamide (PubChem CID 171058063) has the molecular formula C40H44BF3N6O3 and a molecular weight of 724.64 g/mol. Its IUPAC name is 2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]-N-[(3,4,5-trifluorophenyl)methyl]acetamide.
| Compound Name | 2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]-N-[(3,4,5-trifluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 171058063 |
| Molecular Formula | C40H44BF3N6O3 |
| Molecular Weight | 724.64 g/mol |
| Exact Mass | 724.35 |
| IUPAC Name | 2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]-N-[(3,4,5-trifluorophenyl)methyl]acetamide |
| SMILES | CC1(C)OB(CCCCC(NC(c2ccccc2)(c2ccccc2)c2ccccc2)c2nnnn2CC(=O)NCc2cc(F)c(F)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C40H44BF3N6O3/c1-38(2)39(3,4)53-41(52-38)23-15-14-22-34(37-47-48-49-50(37)27-35(51)45-26-28-24-32(42)36(44)33(43)25-28)46-40(29-16-8-5-9-17-29,30-18-10-6-11-19-30)31-20-12-7-13-21-31/h5-13,16-21,24-25,34,46H,14-15,22-23,26-27H2,1-4H3,(H,45,51) |
| InChIKey | HFMOOXSIHPVMRH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|