C15H24BClN6O4 — CID 163282409
[5-amino-5-[1-[2-(benzylamino)-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid;hydrochloride (PubChem CID 163282409) has the molecular formula C15H24BClN6O4 and a molecular weight of 398.66 g/mol. Its IUPAC name is [5-amino-5-[1-[2-(benzylamino)-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid;hydrochloride.
| Compound Name | [5-amino-5-[1-[2-(benzylamino)-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 163282409 |
| Molecular Formula | C15H24BClN6O4 |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [5-amino-5-[1-[2-(benzylamino)-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid;hydrochloride |
| SMILES | Cl.NC(CCCCOB(O)O)c1nnnn1CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H23BN6O4.ClH/c17-13(8-4-5-9-26-16(24)25)15-19-20-21-22(15)11-14(23)18-10-12-6-2-1-3-7-12;/h1-3,6-7,13,24-25H,4-5,8-11,17H2,(H,18,23);1H |
| InChIKey | VGVRXEHZWDVQQQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|