C20H32BN7O4 — CID 163282386
[5-amino-5-[1-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid (PubChem CID 163282386) has the molecular formula C20H32BN7O4 and a molecular weight of 445.33 g/mol. Its IUPAC name is [5-amino-5-[1-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid.
| Compound Name | [5-amino-5-[1-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid |
|---|---|
| PubChem CID | 163282386 |
| Molecular Formula | C20H32BN7O4 |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | [5-amino-5-[1-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid |
| SMILES | NC(CCCCOB(O)O)c1nnnn1CC(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32BN7O4/c22-18(8-4-5-13-32-21(30)31)20-24-25-26-28(20)15-19(29)23-17-9-11-27(12-10-17)14-16-6-2-1-3-7-16/h1-3,6-7,17-18,30-31H,4-5,8-15,22H2,(H,23,29) |
| InChIKey | AJJFRVZVXSESGR-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|