C20H29N7O — CID 45250145
N-(1-benzylpiperidin-3-yl)-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide (PubChem CID 45250145) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 45250145 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nnnc1CN1CCCC1)NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H29N7O/c28-20(16-27-19(22-23-24-27)15-25-10-4-5-11-25)21-18-9-6-12-26(14-18)13-17-7-2-1-3-8-17/h1-3,7-8,18H,4-6,9-16H2,(H,21,28) |
| InChIKey | NGAUISJNDPKNOB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |