C16H21ClN6O — CID 42158113
N-[2-(2-chlorophenyl)ethyl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide (PubChem CID 42158113) has the molecular formula C16H21ClN6O and a molecular weight of 348.84 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 42158113 |
| Molecular Formula | C16H21ClN6O |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nnnc1CN1CCCC1)NCCc1ccccc1Cl |
| InChI | InChI=1S/C16H21ClN6O/c17-14-6-2-1-5-13(14)7-8-18-16(24)12-23-15(19-20-21-23)11-22-9-3-4-10-22/h1-2,5-6H,3-4,7-12H2,(H,18,24) |
| InChIKey | DSPFGHPUBPRZOC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |