C20H29N7O2 — CID 45174100
N-(1-benzylpiperidin-3-yl)-2-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]acetamide (PubChem CID 45174100) has the molecular formula C20H29N7O2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-2-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]acetamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-2-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 45174100 |
| Molecular Formula | C20H29N7O2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-2-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nnnc1CN1CCOCC1)NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H29N7O2/c28-20(16-27-19(22-23-24-27)15-25-9-11-29-12-10-25)21-18-7-4-8-26(14-18)13-17-5-2-1-3-6-17/h1-3,5-6,18H,4,7-16H2,(H,21,28) |
| InChIKey | LNHQQFZERVHWEU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |