C38H42BF2N5O2 — CID 171058005
1-[1-[(2,5-difluorophenyl)methyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine (PubChem CID 171058005) has the molecular formula C38H42BF2N5O2 and a molecular weight of 649.60 g/mol. Its IUPAC name is 1-[1-[(2,5-difluorophenyl)methyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine.
| Compound Name | 1-[1-[(2,5-difluorophenyl)methyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine |
|---|---|
| PubChem CID | 171058005 |
| Molecular Formula | C38H42BF2N5O2 |
| Molecular Weight | 649.60 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | 1-[1-[(2,5-difluorophenyl)methyl]tetrazol-5-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpentan-1-amine |
| SMILES | CC1(C)OB(CCCCC(NC(c2ccccc2)(c2ccccc2)c2ccccc2)c2nnnn2Cc2cc(F)ccc2F)OC1(C)C |
| InChI | InChI=1S/C38H42BF2N5O2/c1-36(2)37(3,4)48-39(47-36)25-15-14-22-34(35-43-44-45-46(35)27-28-26-32(40)23-24-33(28)41)42-38(29-16-8-5-9-17-29,30-18-10-6-11-19-30)31-20-12-7-13-21-31/h5-13,16-21,23-24,26,34,42H,14-15,22,25,27H2,1-4H3 |
| InChIKey | CWJCGBWZMPMBAU-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.60 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|