C40H46BClN6O3 — CID 171058050
N-[(4-chlorophenyl)methyl]-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide (PubChem CID 171058050) has the molecular formula C40H46BClN6O3 and a molecular weight of 705.11 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 171058050 |
| Molecular Formula | C40H46BClN6O3 |
| Molecular Weight | 705.11 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
| SMILES | CC1(C)OB(CCCCC(NC(c2ccccc2)(c2ccccc2)c2ccccc2)c2nnnn2CC(=O)NCc2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C40H46BClN6O3/c1-38(2)39(3,4)51-41(50-38)27-15-14-22-35(37-45-46-47-48(37)29-36(49)43-28-30-23-25-34(42)26-24-30)44-40(31-16-8-5-9-17-31,32-18-10-6-11-19-32)33-20-12-7-13-21-33/h5-13,16-21,23-26,35,44H,14-15,22,27-29H2,1-4H3,(H,43,49) |
| InChIKey | WYOSWVSVVKRLHL-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.11 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|