C21H27BClN7O3 — CID 170795447
[5-[1-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]-5-(pyridin-4-ylmethylamino)pentyl]boronic acid (PubChem CID 170795447) has the molecular formula C21H27BClN7O3 and a molecular weight of 471.76 g/mol. Its IUPAC name is [5-[1-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]-5-(pyridin-4-ylmethylamino)pentyl]boronic acid.
| Compound Name | [5-[1-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]-5-(pyridin-4-ylmethylamino)pentyl]boronic acid |
|---|---|
| PubChem CID | 170795447 |
| Molecular Formula | C21H27BClN7O3 |
| Molecular Weight | 471.76 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | [5-[1-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]-5-(pyridin-4-ylmethylamino)pentyl]boronic acid |
| SMILES | O=C(Cn1nnnc1C(CCCCB(O)O)NCc1ccncc1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27BClN7O3/c23-18-6-4-16(5-7-18)14-26-20(31)15-30-21(27-28-29-30)19(3-1-2-10-22(32)33)25-13-17-8-11-24-12-9-17/h4-9,11-12,19,25,32-33H,1-3,10,13-15H2,(H,26,31) |
| InChIKey | YSPGRZPYKLFZDK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.76 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|