C32H32BFO3 — CID 142578606
2-[4-fluoro-2-(trityloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 142578606) has the molecular formula C32H32BFO3 and a molecular weight of 494.42 g/mol. Its IUPAC name is 2-[4-fluoro-2-(trityloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-fluoro-2-(trityloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142578606 |
| Molecular Formula | C32H32BFO3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-[4-fluoro-2-(trityloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(F)cc2COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C32H32BFO3/c1-30(2)31(3,4)37-33(36-30)29-21-20-28(34)22-24(29)23-35-32(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-22H,23H2,1-4H3 |
| InChIKey | DBGDNALKCYPJMP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|