About [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride
[5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride (PubChem CID 171057986) has the molecular formula C13H19BCl3N5O2
and a molecular weight of 394.50 g/mol. Its IUPAC name is [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride.
Molecular Properties
| Compound Name | [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride |
| PubChem CID | 171057986 |
| Molecular Formula | C13H19BCl3N5O2 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride |
| SMILES | Cl.NC(CCCCB(O)O)c1nnnn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18BCl2N5O2.ClH/c15-10-5-4-9(11(16)7-10)8-21-13(18-19-20-21)12(17)3-1-2-6-14(22)23;/h4-5,7,12,22-23H,1-3,6,8,17H2;1H |
| InChIKey | KBQXUAWMSKJXKU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride?
The IUPAC name of [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride (CID 171057986) is [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride.
What is the SMILES notation for [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride?
The canonical SMILES for [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride is Cl.NC(CCCCB(O)O)c1nnnn1Cc1ccc(Cl)cc1Cl.
What is the InChIKey of [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride?
The InChIKey is KBQXUAWMSKJXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BCl2N5O2.ClH/c15-10-5-4-9(11(16)7-10)8-21-13(18-19-20-21)12(17)3-1-2-6-14(22)23;/h4-5,7,12,22-23H,1-3,6,8,17H2;1H.
What are the key properties of [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride?
[5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride has a molecular weight of 394.50 g/mol, XLogP of 2.09, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-5-[1-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride is sourced from PubChem (CID 171057986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).