C10H9Cl2N5O — CID 14662861
5-amino-1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxamide (PubChem CID 14662861) has the molecular formula C10H9Cl2N5O and a molecular weight of 286.12 g/mol. Its IUPAC name is 5-amino-1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-amino-1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 14662861 |
| Molecular Formula | C10H9Cl2N5O |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 5-amino-1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1nnn(Cc2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C10H9Cl2N5O/c11-6-2-1-5(7(12)3-6)4-17-9(13)8(10(14)18)15-16-17/h1-3H,4,13H2,(H2,14,18) |
| InChIKey | NZTFFEWGDOWPKL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |