C11H9ClN6O — CID 14033032
5-amino-1-[(4-chloro-3-cyanophenyl)methyl]triazole-4-carboxamide (PubChem CID 14033032) has the molecular formula C11H9ClN6O and a molecular weight of 276.69 g/mol. Its IUPAC name is 5-amino-1-[(4-chloro-3-cyanophenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-amino-1-[(4-chloro-3-cyanophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 14033032 |
| Molecular Formula | C11H9ClN6O |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 5-amino-1-[(4-chloro-3-cyanophenyl)methyl]triazole-4-carboxamide |
| SMILES | N#Cc1cc(Cn2nnc(C(N)=O)c2N)ccc1Cl |
| InChI | InChI=1S/C11H9ClN6O/c12-8-2-1-6(3-7(8)4-13)5-18-10(14)9(11(15)19)16-17-18/h1-3H,5,14H2,(H2,15,19) |
| InChIKey | HIVGKPPWBNYDSG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |