C13H17N5O4 — CID 14910600
5-amino-1-[(3,4,5-trimethoxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 14910600) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-amino-1-[(3,4,5-trimethoxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-amino-1-[(3,4,5-trimethoxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 14910600 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-amino-1-[(3,4,5-trimethoxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | COc1cc(Cn2nnc(C(N)=O)c2N)cc(OC)c1OC |
| InChI | InChI=1S/C13H17N5O4/c1-20-8-4-7(5-9(21-2)11(8)22-3)6-18-12(14)10(13(15)19)16-17-18/h4-5H,6,14H2,1-3H3,(H2,15,19) |
| InChIKey | RTOGZYYXHUGSPG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |