C19H29BCl2N2O4 — CID 162223966
[5-amino-5-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]pentyl]boronic acid;carbon dioxide (PubChem CID 162223966) has the molecular formula C19H29BCl2N2O4 and a molecular weight of 431.17 g/mol. Its IUPAC name is [5-amino-5-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]pentyl]boronic acid;carbon dioxide.
| Compound Name | [5-amino-5-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]pentyl]boronic acid;carbon dioxide |
|---|---|
| PubChem CID | 162223966 |
| Molecular Formula | C19H29BCl2N2O4 |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [5-amino-5-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]pentyl]boronic acid;carbon dioxide |
| SMILES | NC(CCCCB(O)O)C1CCN(CCc2ccc(Cl)cc2Cl)CC1.O=C=O |
| InChI | InChI=1S/C18H29BCl2N2O2.CO2/c20-16-5-4-14(17(21)13-16)6-10-23-11-7-15(8-12-23)18(22)3-1-2-9-19(24)25;2-1-3/h4-5,13,15,18,24-25H,1-3,6-12,22H2; |
| InChIKey | ZUMSWSXBZWJYBB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|