C19H29BCl2N2O4 — CID 66833558
2-amino-6-borono-2-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]hexanoic acid (PubChem CID 66833558) has the molecular formula C19H29BCl2N2O4 and a molecular weight of 431.17 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 66833558 |
| Molecular Formula | C19H29BCl2N2O4 |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-amino-6-borono-2-[1-[2-(2,4-dichlorophenyl)ethyl]piperidin-4-yl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCN(CCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H29BCl2N2O4/c21-16-4-3-14(17(22)13-16)5-10-24-11-6-15(7-12-24)19(23,18(25)26)8-1-2-9-20(27)28/h3-4,13,15,27-28H,1-2,5-12,23H2,(H,25,26) |
| InChIKey | TZUNJQFRWWARNO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|