C24H29Cl2NO3 — CID 20544929
1-[4-[2-[2-(2,4-dichlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid (PubChem CID 20544929) has the molecular formula C24H29Cl2NO3 and a molecular weight of 450.41 g/mol. Its IUPAC name is 1-[4-[2-[2-(2,4-dichlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[2-[2-(2,4-dichlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20544929 |
| Molecular Formula | C24H29Cl2NO3 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-[4-[2-[2-(2,4-dichlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(CCCCOc2ccccc2CCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C24H29Cl2NO3/c25-21-10-9-18(22(26)17-21)7-8-19-5-1-2-6-23(19)30-16-4-3-13-27-14-11-20(12-15-27)24(28)29/h1-2,5-6,9-10,17,20H,3-4,7-8,11-16H2,(H,28,29) |
| InChIKey | BVDJEPUPIJZSKR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|