C24H31ClN2O2 — CID 20544942
1-[4-[2-[2-(4-chlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxamide (PubChem CID 20544942) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is 1-[4-[2-[2-(4-chlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[2-[2-(4-chlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20544942 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-[4-[2-[2-(4-chlorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCCOc2ccccc2CCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H31ClN2O2/c25-22-11-8-19(9-12-22)7-10-20-5-1-2-6-23(20)29-18-4-3-15-27-16-13-21(14-17-27)24(26)28/h1-2,5-6,8-9,11-12,21H,3-4,7,10,13-18H2,(H2,26,28) |
| InChIKey | FUEPWYLHOVYBBQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|