C16H20Cl2N2O3 — CID 148887556
2-(4-carbamoylpiperidin-1-yl)ethyl 2-(3,5-dichlorophenyl)acetate (PubChem CID 148887556) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-(4-carbamoylpiperidin-1-yl)ethyl 2-(3,5-dichlorophenyl)acetate.
| Compound Name | 2-(4-carbamoylpiperidin-1-yl)ethyl 2-(3,5-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 148887556 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-(4-carbamoylpiperidin-1-yl)ethyl 2-(3,5-dichlorophenyl)acetate |
| SMILES | NC(=O)C1CCN(CCOC(=O)Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c17-13-7-11(8-14(18)10-13)9-15(21)23-6-5-20-3-1-12(2-4-20)16(19)22/h7-8,10,12H,1-6,9H2,(H2,19,22) |
| InChIKey | PEGUHCGGCIHPLU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |