C15H20Cl2N2O2 — CID 113075233
ethyl 4-[2-(2,4-dichlorophenyl)ethyl]piperazine-1-carboxylate (PubChem CID 113075233) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is ethyl 4-[2-(2,4-dichlorophenyl)ethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2,4-dichlorophenyl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113075233 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | ethyl 4-[2-(2,4-dichlorophenyl)ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-2-21-15(20)19-9-7-18(8-10-19)6-5-12-3-4-13(16)11-14(12)17/h3-4,11H,2,5-10H2,1H3 |
| InChIKey | CMRLQBGIZWSKCV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |