C15H20Cl2N2 — CID 64926673
3-cyclopropyl-1-[2-(2,4-dichlorophenyl)ethyl]piperazine (PubChem CID 64926673) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 3-cyclopropyl-1-[2-(2,4-dichlorophenyl)ethyl]piperazine.
| Compound Name | 3-cyclopropyl-1-[2-(2,4-dichlorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 64926673 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-cyclopropyl-1-[2-(2,4-dichlorophenyl)ethyl]piperazine |
| SMILES | Clc1ccc(CCN2CCNC(C3CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2/c16-13-4-3-11(14(17)9-13)5-7-19-8-6-18-15(10-19)12-1-2-12/h3-4,9,12,15,18H,1-2,5-8,10H2 |
| InChIKey | FCZMPAFXSCWZOC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |