C15H22Cl2N2 — CID 64832896
3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]piperazine (PubChem CID 64832896) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]piperazine.
| Compound Name | 3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 64832896 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]piperazine |
| SMILES | CCC(C)C1CN(Cc2ccc(Cl)cc2Cl)CCN1 |
| InChI | InChI=1S/C15H22Cl2N2/c1-3-11(2)15-10-19(7-6-18-15)9-12-4-5-13(16)8-14(12)17/h4-5,8,11,15,18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | AWVMFOHTEGEPLX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |