C17H26Cl2N2 — CID 64871546
3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]-7-methyl-1,4-diazepane (PubChem CID 64871546) has the molecular formula C17H26Cl2N2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]-7-methyl-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]-7-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 64871546 |
| Molecular Formula | C17H26Cl2N2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-butan-2-yl-1-[(2,4-dichlorophenyl)methyl]-7-methyl-1,4-diazepane |
| SMILES | CCC(C)C1CN(Cc2ccc(Cl)cc2Cl)C(C)CCN1 |
| InChI | InChI=1S/C17H26Cl2N2/c1-4-12(2)17-11-21(13(3)7-8-20-17)10-14-5-6-15(18)9-16(14)19/h5-6,9,12-13,17,20H,4,7-8,10-11H2,1-3H3 |
| InChIKey | QCSQQNQNSCTQGU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |