C12H24F2N2 — CID 64870751
3-butan-2-yl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane (PubChem CID 64870751) has the molecular formula C12H24F2N2 and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 64870751 |
| Molecular Formula | C12H24F2N2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 3-butan-2-yl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane |
| SMILES | CCC(C)C1CN(CC(F)F)C(C)CCN1 |
| InChI | InChI=1S/C12H24F2N2/c1-4-9(2)11-7-16(8-12(13)14)10(3)5-6-15-11/h9-12,15H,4-8H2,1-3H3 |
| InChIKey | VWWNTNKAOWDZDV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |