C12H24F2N2 — CID 64849409
5-butan-2-yl-1-(2,2-difluoroethyl)-2,2-dimethylpiperazine (PubChem CID 64849409) has the molecular formula C12H24F2N2 and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-butan-2-yl-1-(2,2-difluoroethyl)-2,2-dimethylpiperazine.
| Compound Name | 5-butan-2-yl-1-(2,2-difluoroethyl)-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 64849409 |
| Molecular Formula | C12H24F2N2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 5-butan-2-yl-1-(2,2-difluoroethyl)-2,2-dimethylpiperazine |
| SMILES | CCC(C)C1CN(CC(F)F)C(C)(C)CN1 |
| InChI | InChI=1S/C12H24F2N2/c1-5-9(2)10-6-16(7-11(13)14)12(3,4)8-15-10/h9-11,15H,5-8H2,1-4H3 |
| InChIKey | OPTHBJZJCXKDCS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |