C12H25FN2 — CID 80696297
5-butan-2-yl-1-(2-fluoroethyl)-2,2-dimethylpiperazine (PubChem CID 80696297) has the molecular formula C12H25FN2 and a molecular weight of 216.34 g/mol. Its IUPAC name is 5-butan-2-yl-1-(2-fluoroethyl)-2,2-dimethylpiperazine.
| Compound Name | 5-butan-2-yl-1-(2-fluoroethyl)-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 80696297 |
| Molecular Formula | C12H25FN2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 5-butan-2-yl-1-(2-fluoroethyl)-2,2-dimethylpiperazine |
| SMILES | CCC(C)C1CN(CCF)C(C)(C)CN1 |
| InChI | InChI=1S/C12H25FN2/c1-5-10(2)11-8-15(7-6-13)12(3,4)9-14-11/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | NFTBDJXNGKRVNY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |