C24H24BF3O2 — CID 141147481
6,6,6-tris(3-fluorophenyl)hexylboronic acid (PubChem CID 141147481) has the molecular formula C24H24BF3O2 and a molecular weight of 412.26 g/mol. Its IUPAC name is 6,6,6-tris(3-fluorophenyl)hexylboronic acid.
| Compound Name | 6,6,6-tris(3-fluorophenyl)hexylboronic acid |
|---|---|
| PubChem CID | 141147481 |
| Molecular Formula | C24H24BF3O2 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 6,6,6-tris(3-fluorophenyl)hexylboronic acid |
| SMILES | OB(O)CCCCCC(c1cccc(F)c1)(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H24BF3O2/c26-21-10-4-7-18(15-21)24(13-2-1-3-14-25(29)30,19-8-5-11-22(27)16-19)20-9-6-12-23(28)17-20/h4-12,15-17,29-30H,1-3,13-14H2 |
| InChIKey | UCDBJHVAFORIEE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|