C18H19BrF2O — CID 135398253
6-bromo-1,1-bis(3-fluorophenyl)hexan-1-ol (PubChem CID 135398253) has the molecular formula C18H19BrF2O and a molecular weight of 369.25 g/mol. Its IUPAC name is 6-bromo-1,1-bis(3-fluorophenyl)hexan-1-ol.
| Compound Name | 6-bromo-1,1-bis(3-fluorophenyl)hexan-1-ol |
|---|---|
| PubChem CID | 135398253 |
| Molecular Formula | C18H19BrF2O |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 6-bromo-1,1-bis(3-fluorophenyl)hexan-1-ol |
| SMILES | OC(CCCCCBr)(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H19BrF2O/c19-11-3-1-2-10-18(22,14-6-4-8-16(20)12-14)15-7-5-9-17(21)13-15/h4-9,12-13,22H,1-3,10-11H2 |
| InChIKey | QRUODXLIVZIYRO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|