C32H31O3- — CID 101047769
4-(7,7,7-triphenylheptoxy)benzoate (PubChem CID 101047769) has the molecular formula C32H31O3- and a molecular weight of 463.60 g/mol. Its IUPAC name is 4-(7,7,7-triphenylheptoxy)benzoate.
| Compound Name | 4-(7,7,7-triphenylheptoxy)benzoate |
|---|---|
| PubChem CID | 101047769 |
| Molecular Formula | C32H31O3- |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 4-(7,7,7-triphenylheptoxy)benzoate |
| SMILES | O=C([O-])c1ccc(OCCCCCCC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32O3/c33-31(34)26-20-22-30(23-21-26)35-25-13-2-1-12-24-32(27-14-6-3-7-15-27,28-16-8-4-9-17-28)29-18-10-5-11-19-29/h3-11,14-23H,1-2,12-13,24-25H2,(H,33,34)/p-1 |
| InChIKey | SEXQFKUADZLRJK-UHFFFAOYSA-M |
| XLogP | 6.41 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|