C8H13BNOP — CID 140793311
2-[phenyl(phosphanyl)boranyl]oxyethanamine (PubChem CID 140793311) has the molecular formula C8H13BNOP and a molecular weight of 180.98 g/mol. Its IUPAC name is 2-[phenyl(phosphanyl)boranyl]oxyethanamine.
| Compound Name | 2-[phenyl(phosphanyl)boranyl]oxyethanamine |
|---|---|
| PubChem CID | 140793311 |
| Molecular Formula | C8H13BNOP |
| Molecular Weight | 180.98 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 2-[phenyl(phosphanyl)boranyl]oxyethanamine |
| SMILES | NCCOB(P)c1ccccc1 |
| InChI | InChI=1S/C8H13BNOP/c10-6-7-11-9(12)8-4-2-1-3-5-8/h1-5H,6-7,10,12H2 |
| InChIKey | SHMKBAVRWYQPHX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.98 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|