C17H24BNO — CID 162089768
2-[(4-ethylphenyl)-phenylboranyl]oxyethanamine;methane (PubChem CID 162089768) has the molecular formula C17H24BNO and a molecular weight of 269.20 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)-phenylboranyl]oxyethanamine;methane.
| Compound Name | 2-[(4-ethylphenyl)-phenylboranyl]oxyethanamine;methane |
|---|---|
| PubChem CID | 162089768 |
| Molecular Formula | C17H24BNO |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 2-[(4-ethylphenyl)-phenylboranyl]oxyethanamine;methane |
| SMILES | C.CCc1ccc(B(OCCN)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H20BNO.CH4/c1-2-14-8-10-16(11-9-14)17(19-13-12-18)15-6-4-3-5-7-15;/h3-11H,2,12-13,18H2,1H3;1H4 |
| InChIKey | ZDLFVLUAADUOAD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|