C21H31BN2O2 — CID 157115587
[(4-ethylphenyl)-phenylboranyl] 2,6-diaminohexanoate;methane (PubChem CID 157115587) has the molecular formula C21H31BN2O2 and a molecular weight of 354.30 g/mol. Its IUPAC name is [(4-ethylphenyl)-phenylboranyl] 2,6-diaminohexanoate;methane.
| Compound Name | [(4-ethylphenyl)-phenylboranyl] 2,6-diaminohexanoate;methane |
|---|---|
| PubChem CID | 157115587 |
| Molecular Formula | C21H31BN2O2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | [(4-ethylphenyl)-phenylboranyl] 2,6-diaminohexanoate;methane |
| SMILES | C.CCc1ccc(B(OC(=O)C(N)CCCCN)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H27BN2O2.CH4/c1-2-16-11-13-18(14-12-16)21(17-8-4-3-5-9-17)25-20(24)19(23)10-6-7-15-22;/h3-5,8-9,11-14,19H,2,6-7,10,15,22-23H2,1H3;1H4 |
| InChIKey | AHJBHTZQBUJAKR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|