C33H34B2N4O5S — CID 58413974
[[8-[2-aminopropanoyloxy(phenyl)boranyl]dibenzothiophen-2-yl]-phenylboranyl] 2-amino-5-(carbamoylamino)pentanoate (PubChem CID 58413974) has the molecular formula C33H34B2N4O5S and a molecular weight of 620.35 g/mol. Its IUPAC name is [[8-[2-aminopropanoyloxy(phenyl)boranyl]dibenzothiophen-2-yl]-phenylboranyl] 2-amino-5-(carbamoylamino)pentanoate.
| Compound Name | [[8-[2-aminopropanoyloxy(phenyl)boranyl]dibenzothiophen-2-yl]-phenylboranyl] 2-amino-5-(carbamoylamino)pentanoate |
|---|---|
| PubChem CID | 58413974 |
| Molecular Formula | C33H34B2N4O5S |
| Molecular Weight | 620.35 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | [[8-[2-aminopropanoyloxy(phenyl)boranyl]dibenzothiophen-2-yl]-phenylboranyl] 2-amino-5-(carbamoylamino)pentanoate |
| SMILES | CC(N)C(=O)OB(c1ccccc1)c1ccc2sc3ccc(B(OC(=O)C(N)CCCNC(N)=O)c4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C33H34B2N4O5S/c1-21(36)31(40)43-34(22-9-4-2-5-10-22)24-14-16-29-26(19-24)27-20-25(15-17-30(27)45-29)35(23-11-6-3-7-12-23)44-32(41)28(37)13-8-18-39-33(38)42/h2-7,9-12,14-17,19-21,28H,8,13,18,36-37H2,1H3,(H3,38,39,42) |
| InChIKey | GFBUDUOIMCKGCZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 159.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|