C17H21BN2O3 — CID 59273393
[[4-(hydroxymethyl)phenyl]-phenylboranyl] 2,4-diaminobutanoate (PubChem CID 59273393) has the molecular formula C17H21BN2O3 and a molecular weight of 312.18 g/mol. Its IUPAC name is [[4-(hydroxymethyl)phenyl]-phenylboranyl] 2,4-diaminobutanoate.
| Compound Name | [[4-(hydroxymethyl)phenyl]-phenylboranyl] 2,4-diaminobutanoate |
|---|---|
| PubChem CID | 59273393 |
| Molecular Formula | C17H21BN2O3 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [[4-(hydroxymethyl)phenyl]-phenylboranyl] 2,4-diaminobutanoate |
| SMILES | NCCC(N)C(=O)OB(c1ccccc1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C17H21BN2O3/c19-11-10-16(20)17(22)23-18(14-4-2-1-3-5-14)15-8-6-13(12-21)7-9-15/h1-9,16,21H,10-12,19-20H2 |
| InChIKey | VSAZSSVYDIAMLA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|