C10H17N3O2 — CID 87691062
N,N-bis(2-aminoethoxy)aniline (PubChem CID 87691062) has the molecular formula C10H17N3O2 and a molecular weight of 211.27 g/mol. Its IUPAC name is N,N-bis(2-aminoethoxy)aniline.
| Compound Name | N,N-bis(2-aminoethoxy)aniline |
|---|---|
| PubChem CID | 87691062 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N,N-bis(2-aminoethoxy)aniline |
| SMILES | NCCON(OCCN)c1ccccc1 |
| InChI | InChI=1S/C10H17N3O2/c11-6-8-14-13(15-9-7-12)10-4-2-1-3-5-10/h1-5H,6-9,11-12H2 |
| InChIKey | KAXHVBOPSPXESB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|