About N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride
N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride (PubChem CID 172990021) has the molecular formula C8H12ClN3O
and a molecular weight of 201.66 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride |
| PubChem CID | 172990021 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride |
| SMILES | Cl.NCCN(N=O)c1ccccc1 |
| InChI | InChI=1S/C8H11N3O.ClH/c9-6-7-11(10-12)8-4-2-1-3-5-8;/h1-5H,6-7,9H2;1H |
| InChIKey | QQUOZTCSWDAMNJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride (CID 172990021) is N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride is Cl.NCCN(N=O)c1ccccc1.
What is the InChIKey of N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride?
The InChIKey is QQUOZTCSWDAMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O.ClH/c9-6-7-11(10-12)8-4-2-1-3-5-8;/h1-5H,6-7,9H2;1H.
What are the key properties of N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride?
N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride has a molecular weight of 201.66 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N-phenylnitrous amide;hydrochloride is sourced from PubChem (CID 172990021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).