About N-amino-N-phenylnitrous amide;azane
N-amino-N-phenylnitrous amide;azane (PubChem CID 174470664) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-amino-N-phenylnitrous amide;azane.
Molecular Properties
| Compound Name | N-amino-N-phenylnitrous amide;azane |
| PubChem CID | 174470664 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N-amino-N-phenylnitrous amide;azane |
| SMILES | N.NN(N=O)c1ccccc1 |
| InChI | InChI=1S/C6H7N3O.H3N/c7-9(8-10)6-4-2-1-3-5-6;/h1-5H,7H2;1H3 |
| InChIKey | DCEICPVTLVPVBY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N-phenylnitrous amide;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N-phenylnitrous amide;azane?
The IUPAC name of N-amino-N-phenylnitrous amide;azane (CID 174470664) is N-amino-N-phenylnitrous amide;azane.
What is the SMILES notation for N-amino-N-phenylnitrous amide;azane?
The canonical SMILES for N-amino-N-phenylnitrous amide;azane is N.NN(N=O)c1ccccc1.
What is the InChIKey of N-amino-N-phenylnitrous amide;azane?
The InChIKey is DCEICPVTLVPVBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O.H3N/c7-9(8-10)6-4-2-1-3-5-6;/h1-5H,7H2;1H3.
What are the key properties of N-amino-N-phenylnitrous amide;azane?
N-amino-N-phenylnitrous amide;azane has a molecular weight of 154.17 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N-phenylnitrous amide;azane is sourced from PubChem (CID 174470664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).