About N,N-bis(sulfanyl)aniline;hydrazine
N,N-bis(sulfanyl)aniline;hydrazine (PubChem CID 159490218) has the molecular formula C6H11N3S2
and a molecular weight of 189.31 g/mol. Its IUPAC name is N,N-bis(sulfanyl)aniline;hydrazine.
Molecular Properties
| Compound Name | N,N-bis(sulfanyl)aniline;hydrazine |
| PubChem CID | 159490218 |
| Molecular Formula | C6H11N3S2 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | N,N-bis(sulfanyl)aniline;hydrazine |
| SMILES | NN.SN(S)c1ccccc1 |
| InChI | InChI=1S/C6H7NS2.H4N2/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5,8-9H;1-2H2 |
| InChIKey | LYCCGKRACIPNEM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(sulfanyl)aniline;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(sulfanyl)aniline;hydrazine?
The IUPAC name of N,N-bis(sulfanyl)aniline;hydrazine (CID 159490218) is N,N-bis(sulfanyl)aniline;hydrazine.
What is the SMILES notation for N,N-bis(sulfanyl)aniline;hydrazine?
The canonical SMILES for N,N-bis(sulfanyl)aniline;hydrazine is NN.SN(S)c1ccccc1.
What is the InChIKey of N,N-bis(sulfanyl)aniline;hydrazine?
The InChIKey is LYCCGKRACIPNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS2.H4N2/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5,8-9H;1-2H2.
What are the key properties of N,N-bis(sulfanyl)aniline;hydrazine?
N,N-bis(sulfanyl)aniline;hydrazine has a molecular weight of 189.31 g/mol, XLogP of 1.00, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(sulfanyl)aniline;hydrazine is sourced from PubChem (CID 159490218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).