About 1-iodo-1-phenylhydrazine;hydrochloride
1-iodo-1-phenylhydrazine;hydrochloride (PubChem CID 53433717) has the molecular formula C6H8ClIN2
and a molecular weight of 270.50 g/mol. Its IUPAC name is 1-iodo-1-phenylhydrazine;hydrochloride.
Molecular Properties
| Compound Name | 1-iodo-1-phenylhydrazine;hydrochloride |
| PubChem CID | 53433717 |
| Molecular Formula | C6H8ClIN2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 1-iodo-1-phenylhydrazine;hydrochloride |
| SMILES | Cl.NN(I)c1ccccc1 |
| InChI | InChI=1S/C6H7IN2.ClH/c7-9(8)6-4-2-1-3-5-6;/h1-5H,8H2;1H |
| InChIKey | UVHJARBTAYHOQU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1-phenylhydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1-phenylhydrazine;hydrochloride?
The IUPAC name of 1-iodo-1-phenylhydrazine;hydrochloride (CID 53433717) is 1-iodo-1-phenylhydrazine;hydrochloride.
What is the SMILES notation for 1-iodo-1-phenylhydrazine;hydrochloride?
The canonical SMILES for 1-iodo-1-phenylhydrazine;hydrochloride is Cl.NN(I)c1ccccc1.
What is the InChIKey of 1-iodo-1-phenylhydrazine;hydrochloride?
The InChIKey is UVHJARBTAYHOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2.ClH/c7-9(8)6-4-2-1-3-5-6;/h1-5H,8H2;1H.
What are the key properties of 1-iodo-1-phenylhydrazine;hydrochloride?
1-iodo-1-phenylhydrazine;hydrochloride has a molecular weight of 270.50 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1-phenylhydrazine;hydrochloride is sourced from PubChem (CID 53433717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).