About manganese(2+);bis(N-oxido-N-phenylnitrous amide)
manganese(2+);bis(N-oxido-N-phenylnitrous amide) (PubChem CID 131874368) has the molecular formula C12H10MnN4O4
and a molecular weight of 329.17 g/mol. Its IUPAC name is manganese(2+);bis(N-oxido-N-phenylnitrous amide).
Molecular Properties
| Compound Name | manganese(2+);bis(N-oxido-N-phenylnitrous amide) |
| PubChem CID | 131874368 |
| Molecular Formula | C12H10MnN4O4 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | manganese(2+);bis(N-oxido-N-phenylnitrous amide) |
| SMILES | O=NN([O-])c1ccccc1.O=NN([O-])c1ccccc1.[Mn+2] |
| InChI | InChI=1S/2C6H5N2O2.Mn/c2*9-7-8(10)6-4-2-1-3-5-6;/h2*1-5H;/q2*-1;+2 |
| InChIKey | YFUDMJCXHNSXRU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(N-oxido-N-phenylnitrous amide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(N-oxido-N-phenylnitrous amide)?
The IUPAC name of manganese(2+);bis(N-oxido-N-phenylnitrous amide) (CID 131874368) is manganese(2+);bis(N-oxido-N-phenylnitrous amide).
What is the SMILES notation for manganese(2+);bis(N-oxido-N-phenylnitrous amide)?
The canonical SMILES for manganese(2+);bis(N-oxido-N-phenylnitrous amide) is O=NN([O-])c1ccccc1.O=NN([O-])c1ccccc1.[Mn+2].
What is the InChIKey of manganese(2+);bis(N-oxido-N-phenylnitrous amide)?
The InChIKey is YFUDMJCXHNSXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5N2O2.Mn/c2*9-7-8(10)6-4-2-1-3-5-6;/h2*1-5H;/q2*-1;+2.
What are the key properties of manganese(2+);bis(N-oxido-N-phenylnitrous amide)?
manganese(2+);bis(N-oxido-N-phenylnitrous amide) has a molecular weight of 329.17 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(N-oxido-N-phenylnitrous amide) is sourced from PubChem (CID 131874368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).