C11H16N2 — CID 67884989
N'-phenyl-N'-prop-2-enylethane-1,2-diamine (PubChem CID 67884989) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N'-phenyl-N'-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-phenyl-N'-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 67884989 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N'-phenyl-N'-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCN(CCN)c1ccccc1 |
| InChI | InChI=1S/C11H16N2/c1-2-9-13(10-8-12)11-6-4-3-5-7-11/h2-7H,1,8-10,12H2 |
| InChIKey | WXNHXWIWNPSCMI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|